C14H11N5O — CID 170970500
4-[2-(pyridin-3-ylamino)pyrimidin-4-yl]-1H-pyridin-2-one (PubChem CID 170970500) has the molecular formula C14H11N5O and a molecular weight of 265.28 g/mol. Its IUPAC name is 4-[2-(pyridin-3-ylamino)pyrimidin-4-yl]-1H-pyridin-2-one.
| Compound Name | 4-[2-(pyridin-3-ylamino)pyrimidin-4-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 170970500 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-[2-(pyridin-3-ylamino)pyrimidin-4-yl]-1H-pyridin-2-one |
| SMILES | O=c1cc(-c2ccnc(Nc3cccnc3)n2)cc[nH]1 |
| InChI | InChI=1S/C14H11N5O/c20-13-8-10(3-6-16-13)12-4-7-17-14(19-12)18-11-2-1-5-15-9-11/h1-9H,(H,16,20)(H,17,18,19) |
| InChIKey | DJDNSIRPMGAZBI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |