C20H15N5O — CID 142533764
4-(2-anilinopyrimidin-4-yl)-6-pyridin-4-yl-1H-pyridin-2-one (PubChem CID 142533764) has the molecular formula C20H15N5O and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-(2-anilinopyrimidin-4-yl)-6-pyridin-4-yl-1H-pyridin-2-one.
| Compound Name | 4-(2-anilinopyrimidin-4-yl)-6-pyridin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 142533764 |
| Molecular Formula | C20H15N5O |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-(2-anilinopyrimidin-4-yl)-6-pyridin-4-yl-1H-pyridin-2-one |
| SMILES | O=c1cc(-c2ccnc(Nc3ccccc3)n2)cc(-c2ccncc2)[nH]1 |
| InChI | InChI=1S/C20H15N5O/c26-19-13-15(12-18(24-19)14-6-9-21-10-7-14)17-8-11-22-20(25-17)23-16-4-2-1-3-5-16/h1-13H,(H,24,26)(H,22,23,25) |
| InChIKey | XPYHHTPXESGWCC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |