C15H20N2O3 — CID 170974305
4-tert-butyl-5,6,7-trimethoxyquinazoline (PubChem CID 170974305) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-tert-butyl-5,6,7-trimethoxyquinazoline.
| Compound Name | 4-tert-butyl-5,6,7-trimethoxyquinazoline |
|---|---|
| PubChem CID | 170974305 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-tert-butyl-5,6,7-trimethoxyquinazoline |
| SMILES | COc1cc2ncnc(C(C)(C)C)c2c(OC)c1OC |
| InChI | InChI=1S/C15H20N2O3/c1-15(2,3)14-11-9(16-8-17-14)7-10(18-4)12(19-5)13(11)20-6/h7-8H,1-6H3 |
| InChIKey | HKROMXLREFRBFY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |