C15H24N2O — CID 176567251
ethane;5-methoxy-4,7-dimethylquinazoline (PubChem CID 176567251) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is ethane;5-methoxy-4,7-dimethylquinazoline.
| Compound Name | ethane;5-methoxy-4,7-dimethylquinazoline |
|---|---|
| PubChem CID | 176567251 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | ethane;5-methoxy-4,7-dimethylquinazoline |
| SMILES | CC.CC.COc1cc(C)cc2ncnc(C)c12 |
| InChI | InChI=1S/C11H12N2O.2C2H6/c1-7-4-9-11(10(5-7)14-3)8(2)12-6-13-9;2*1-2/h4-6H,1-3H3;2*1-2H3 |
| InChIKey | YFEVVMUULDDSAW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |