C33H41N3O4 — CID 170975678
2-[4-[(6S)-2-butyl-7-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-7-azaspiro[3.5]nonan-6-yl]benzoyl]iminopropanoic acid (PubChem CID 170975678) has the molecular formula C33H41N3O4 and a molecular weight of 543.71 g/mol. Its IUPAC name is 2-[4-[(6S)-2-butyl-7-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-7-azaspiro[3.5]nonan-6-yl]benzoyl]iminopropanoic acid.
| Compound Name | 2-[4-[(6S)-2-butyl-7-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-7-azaspiro[3.5]nonan-6-yl]benzoyl]iminopropanoic acid |
|---|---|
| PubChem CID | 170975678 |
| Molecular Formula | C33H41N3O4 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | 2-[4-[(6S)-2-butyl-7-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-7-azaspiro[3.5]nonan-6-yl]benzoyl]iminopropanoic acid |
| SMILES | CCCCC1CC2(CCN(Cc3c(OC)cc(C)c4[nH]ccc34)[C@H](c3ccc(C(=O)/N=C(\C)C(=O)O)cc3)C2)C1 |
| InChI | InChI=1S/C33H41N3O4/c1-5-6-7-23-17-33(18-23)13-15-36(20-27-26-12-14-34-30(26)21(2)16-29(27)40-4)28(19-33)24-8-10-25(11-9-24)31(37)35-22(3)32(38)39/h8-12,14,16,23,28,34H,5-7,13,15,17-20H2,1-4H3,(H,38,39)/b35-22+/t23?,28-,33?/m0/s1 |
| InChIKey | TYCWIFCOFVOSPF-QCWUQBJFSA-N |
| XLogP | 7.09 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|