About N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane
N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane (PubChem CID 170976846) has the molecular formula C20H20ClN3O3S2
and a molecular weight of 449.99 g/mol. Its IUPAC name is N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane.
Molecular Properties
| Compound Name | N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane |
| PubChem CID | 170976846 |
| Molecular Formula | C20H20ClN3O3S2 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane |
| SMILES | CN(SONc1cccc(Cl)c1)c1ccc(NC(=O)c2ccccc2O)cc1.S |
| InChI | InChI=1S/C20H18ClN3O3S.H2S/c1-24(28-27-23-16-6-4-5-14(21)13-16)17-11-9-15(10-12-17)22-20(26)18-7-2-3-8-19(18)25;/h2-13,23,25H,1H3,(H,22,26);1H2 |
| InChIKey | HUBMZAPSOHCXRG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane?
The IUPAC name of N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane (CID 170976846) is N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane.
What is the SMILES notation for N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane?
The canonical SMILES for N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane is CN(SONc1cccc(Cl)c1)c1ccc(NC(=O)c2ccccc2O)cc1.S.
What is the InChIKey of N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane?
The InChIKey is HUBMZAPSOHCXRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClN3O3S.H2S/c1-24(28-27-23-16-6-4-5-14(21)13-16)17-11-9-15(10-12-17)22-20(26)18-7-2-3-8-19(18)25;/h2-13,23,25H,1H3,(H,22,26);1H2.
What are the key properties of N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane?
N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane has a molecular weight of 449.99 g/mol, XLogP of 5.45, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(3-chloroanilino)oxysulfanyl-methylamino]phenyl]-2-hydroxybenzamide;sulfane is sourced from PubChem (CID 170976846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).