C21H19Cl3NO5PS — CID 19390439
2-hydroxy-N-phenylbenzamide;1,2,4-trichloro-5-dimethoxyphosphorylsulfanylbenzene (PubChem CID 19390439) has the molecular formula C21H19Cl3NO5PS and a molecular weight of 534.79 g/mol. Its IUPAC name is 2-hydroxy-N-phenylbenzamide;1,2,4-trichloro-5-dimethoxyphosphorylsulfanylbenzene.
| Compound Name | 2-hydroxy-N-phenylbenzamide;1,2,4-trichloro-5-dimethoxyphosphorylsulfanylbenzene |
|---|---|
| PubChem CID | 19390439 |
| Molecular Formula | C21H19Cl3NO5PS |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 532.98 |
| IUPAC Name | 2-hydroxy-N-phenylbenzamide;1,2,4-trichloro-5-dimethoxyphosphorylsulfanylbenzene |
| SMILES | COP(=O)(OC)Sc1cc(Cl)c(Cl)cc1Cl.O=C(Nc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C13H11NO2.C8H8Cl3O3PS/c15-12-9-5-4-8-11(12)13(16)14-10-6-2-1-3-7-10;1-13-15(12,14-2)16-8-4-6(10)5(9)3-7(8)11/h1-9,15H,(H,14,16);3-4H,1-2H3 |
| InChIKey | UXTGVUZHVPZRQZ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|