C28H25NO6 — CID 67727277
2-hydroxy-N-phenylbenzamide;methyl 2,2-bis(4-hydroxyphenyl)acetate (PubChem CID 67727277) has the molecular formula C28H25NO6 and a molecular weight of 471.51 g/mol. Its IUPAC name is 2-hydroxy-N-phenylbenzamide;methyl 2,2-bis(4-hydroxyphenyl)acetate.
| Compound Name | 2-hydroxy-N-phenylbenzamide;methyl 2,2-bis(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 67727277 |
| Molecular Formula | C28H25NO6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-hydroxy-N-phenylbenzamide;methyl 2,2-bis(4-hydroxyphenyl)acetate |
| SMILES | COC(=O)C(c1ccc(O)cc1)c1ccc(O)cc1.O=C(Nc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C15H14O4.C13H11NO2/c1-19-15(18)14(10-2-6-12(16)7-3-10)11-4-8-13(17)9-5-11;15-12-9-5-4-8-11(12)13(16)14-10-6-2-1-3-7-10/h2-9,14,16-17H,1H3;1-9,15H,(H,14,16) |
| InChIKey | IPESZCFCJFYWDV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |