C19H34N4O8 — CID 170982653
N-[(3aR,4R,7R,7aR)-4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]acetamide (PubChem CID 170982653) has the molecular formula C19H34N4O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is N-[(3aR,4R,7R,7aR)-4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]acetamide.
| Compound Name | N-[(3aR,4R,7R,7aR)-4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]acetamide |
|---|---|
| PubChem CID | 170982653 |
| Molecular Formula | C19H34N4O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[(3aR,4R,7R,7aR)-4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CO[C@H](COCCOCCOCCOCCN=[N+]=[N-])[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C19H34N4O8/c1-14(24)22-15-12-29-16(18-17(15)30-19(2,3)31-18)13-28-11-10-27-9-8-26-7-6-25-5-4-21-23-20/h15-18H,4-13H2,1-3H3,(H,22,24)/t15-,16-,17-,18+/m1/s1 |
| InChIKey | YIMMOMGENDOVPP-TVFCKZIOSA-N |
| XLogP | 0.79 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|