C16H17ClN4O — CID 170983610
2-tert-butyl-5-[[(3-chlorophenyl)methylideneamino]-methylamino]-1,3-oxazole-4-carbonitrile (PubChem CID 170983610) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-tert-butyl-5-[[(3-chlorophenyl)methylideneamino]-methylamino]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-tert-butyl-5-[[(3-chlorophenyl)methylideneamino]-methylamino]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 170983610 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-tert-butyl-5-[[(3-chlorophenyl)methylideneamino]-methylamino]-1,3-oxazole-4-carbonitrile |
| SMILES | CN(N=Cc1cccc(Cl)c1)c1oc(C(C)(C)C)nc1C#N |
| InChI | InChI=1S/C16H17ClN4O/c1-16(2,3)15-20-13(9-18)14(22-15)21(4)19-10-11-6-5-7-12(17)8-11/h5-8,10H,1-4H3 |
| InChIKey | OZJRYCKFKXUECX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 65.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|