C24H36O2 — CID 170988022
ethyl 2,3,4,5,6-pentadeuteriodocosa-2,4,6,8,10,12-hexaenoate (PubChem CID 170988022) has the molecular formula C24H36O2 and a molecular weight of 361.58 g/mol. Its IUPAC name is ethyl 2,3,4,5,6-pentadeuteriodocosa-2,4,6,8,10,12-hexaenoate.
| Compound Name | ethyl 2,3,4,5,6-pentadeuteriodocosa-2,4,6,8,10,12-hexaenoate |
|---|---|
| PubChem CID | 170988022 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 361.58 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | ethyl 2,3,4,5,6-pentadeuteriodocosa-2,4,6,8,10,12-hexaenoate |
| SMILES | [2H]C(=CC=CC=CC=CCCCCCCCCC)C([2H])=C([2H])C([2H])=C([2H])C(=O)OCC |
| InChI | InChI=1S/C24H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26-4-2/h12-23H,3-11H2,1-2H3/i19D,20D,21D,22D,23D |
| InChIKey | TYLNXKAVUJJPMU-MIEZRAGMSA-N |
| XLogP | 7.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.58 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|