About (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride
(3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride (PubChem CID 170988161) has the molecular formula C10H12ClN3O5
and a molecular weight of 289.68 g/mol. Its IUPAC name is (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride.
Molecular Properties
| Compound Name | (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride |
| PubChem CID | 170988161 |
| Molecular Formula | C10H12ClN3O5 |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride |
| SMILES | Cl.NC(=O)[C@H](CC(=O)O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H11N3O5.ClH/c11-10(16)8(5-9(14)15)12-6-1-3-7(4-2-6)13(17)18;/h1-4,8,12H,5H2,(H2,11,16)(H,14,15);1H/t8-;/m0./s1 |
| InChIKey | JANCSVWUDXKGTR-QRPNPIFTSA-N |
| XLogP | 0.76 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride?
The IUPAC name of (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride (CID 170988161) is (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride.
What is the SMILES notation for (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride?
The canonical SMILES for (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride is Cl.NC(=O)[C@H](CC(=O)O)Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride?
The InChIKey is JANCSVWUDXKGTR-QRPNPIFTSA-N. The full InChI is InChI=1S/C10H11N3O5.ClH/c11-10(16)8(5-9(14)15)12-6-1-3-7(4-2-6)13(17)18;/h1-4,8,12H,5H2,(H2,11,16)(H,14,15);1H/t8-;/m0./s1.
What are the key properties of (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride?
(3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride has a molecular weight of 289.68 g/mol, XLogP of 0.76, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-amino-3-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride is sourced from PubChem (CID 170988161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).