C29H35NO5 — CID 170990310
(1S,3R,4S,7S,8S,10R,12S,13R,14S,21R,25S,26S)-3,21-dihydroxy-10,12-dimethyl-15-oxa-22-azaheptacyclo[12.9.3.216,19.11,21.04,25.07,26.08,13]nonacosa-5,16,18,28-tetraene-23,24-dione (PubChem CID 170990310) has the molecular formula C29H35NO5 and a molecular weight of 477.60 g/mol. Its IUPAC name is (1S,3R,4S,7S,8S,10R,12S,13R,14S,21R,25S,26S)-3,21-dihydroxy-10,12-dimethyl-15-oxa-22-azaheptacyclo[12.9.3.216,19.11,21.04,25.07,26.08,13]nonacosa-5,16,18,28-tetraene-23,24-dione.
| Compound Name | (1S,3R,4S,7S,8S,10R,12S,13R,14S,21R,25S,26S)-3,21-dihydroxy-10,12-dimethyl-15-oxa-22-azaheptacyclo[12.9.3.216,19.11,21.04,25.07,26.08,13]nonacosa-5,16,18,28-tetraene-23,24-dione |
|---|---|
| PubChem CID | 170990310 |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | (1S,3R,4S,7S,8S,10R,12S,13R,14S,21R,25S,26S)-3,21-dihydroxy-10,12-dimethyl-15-oxa-22-azaheptacyclo[12.9.3.216,19.11,21.04,25.07,26.08,13]nonacosa-5,16,18,28-tetraene-23,24-dione |
| SMILES | C[C@H]1C[C@H]2[C@@H]3C=C[C@H]4[C@@H]5C(=O)[C@]6(C[C@H]4O)C[C@](O)(Cc4ccc(cc4)O[C@H]([C@@H]35)[C@@H]2[C@@H](C)C1)NC6=O |
| InChI | InChI=1S/C29H35NO5/c1-14-9-15(2)22-20(10-14)18-7-8-19-21(31)12-28-13-29(34,30-27(28)33)11-16-3-5-17(6-4-16)35-25(22)23(18)24(19)26(28)32/h3-8,14-15,18-25,31,34H,9-13H2,1-2H3,(H,30,33)/t14-,15+,18+,19-,20+,21-,22-,23+,24+,25+,28+,29-/m1/s1 |
| InChIKey | LRYAMUIPQBLDBG-QHHMGBMXSA-N |
| XLogP | 2.87 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|