C29H35NO4 — CID 170990314
(3S,4R,5S,7R,9S,10S,13R,14S,16S,19S,27S)-13-ethenyl-19-hydroxy-5,7-dimethyl-2-oxa-18-azahexacyclo[19.2.2.13,10.116,19.04,9.014,27]heptacosa-1(24),11,21(25),22-tetraene-15,17-dione (PubChem CID 170990314) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is (3S,4R,5S,7R,9S,10S,13R,14S,16S,19S,27S)-13-ethenyl-19-hydroxy-5,7-dimethyl-2-oxa-18-azahexacyclo[19.2.2.13,10.116,19.04,9.014,27]heptacosa-1(24),11,21(25),22-tetraene-15,17-dione.
| Compound Name | (3S,4R,5S,7R,9S,10S,13R,14S,16S,19S,27S)-13-ethenyl-19-hydroxy-5,7-dimethyl-2-oxa-18-azahexacyclo[19.2.2.13,10.116,19.04,9.014,27]heptacosa-1(24),11,21(25),22-tetraene-15,17-dione |
|---|---|
| PubChem CID | 170990314 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | (3S,4R,5S,7R,9S,10S,13R,14S,16S,19S,27S)-13-ethenyl-19-hydroxy-5,7-dimethyl-2-oxa-18-azahexacyclo[19.2.2.13,10.116,19.04,9.014,27]heptacosa-1(24),11,21(25),22-tetraene-15,17-dione |
| SMILES | C=C[C@@H]1C=C[C@H]2[C@@H]3C[C@H](C)C[C@H](C)[C@H]3[C@@H]3Oc4ccc(cc4)C[C@@]4(O)C[C@H](C(=O)N4)C(=O)[C@@H]1[C@H]23 |
| InChI | InChI=1S/C29H35NO4/c1-4-18-7-10-20-21-12-15(2)11-16(3)23(21)27-25(20)24(18)26(31)22-14-29(33,30-28(22)32)13-17-5-8-19(34-27)9-6-17/h4-10,15-16,18,20-25,27,33H,1,11-14H2,2-3H3,(H,30,32)/t15-,16+,18-,20+,21+,22+,23-,24+,25+,27+,29-/m1/s1 |
| InChIKey | NZJRFVHZFAKZDF-KGMYGWHHSA-N |
| XLogP | 3.92 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|