C22H36N2O3 — CID 170990661
6,6-dimethyl-N-[(Z)-3-methyl-5-oxo-5-[(2S)-5-oxo-2-propan-2-yl-2H-pyrrol-1-yl]pent-3-enyl]heptanamide (PubChem CID 170990661) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is 6,6-dimethyl-N-[(Z)-3-methyl-5-oxo-5-[(2S)-5-oxo-2-propan-2-yl-2H-pyrrol-1-yl]pent-3-enyl]heptanamide.
| Compound Name | 6,6-dimethyl-N-[(Z)-3-methyl-5-oxo-5-[(2S)-5-oxo-2-propan-2-yl-2H-pyrrol-1-yl]pent-3-enyl]heptanamide |
|---|---|
| PubChem CID | 170990661 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | 6,6-dimethyl-N-[(Z)-3-methyl-5-oxo-5-[(2S)-5-oxo-2-propan-2-yl-2H-pyrrol-1-yl]pent-3-enyl]heptanamide |
| SMILES | C/C(=C/C(=O)N1C(=O)C=C[C@@H]1C(C)C)CCNC(=O)CCCCC(C)(C)C |
| InChI | InChI=1S/C22H36N2O3/c1-16(2)18-10-11-20(26)24(18)21(27)15-17(3)12-14-23-19(25)9-7-8-13-22(4,5)6/h10-11,15-16,18H,7-9,12-14H2,1-6H3,(H,23,25)/b17-15-/t18-/m1/s1 |
| InChIKey | QXVCNMLAGPNUAM-RZPKCTKSSA-N |
| XLogP | 4.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|