C35H28O7 — CID 170995384
9-hydroxy-2,6,8-tris[(4-hydroxyphenyl)methyl]-2-methoxycyclopenta[a]naphthalene-1,3-dione (PubChem CID 170995384) has the molecular formula C35H28O7 and a molecular weight of 560.60 g/mol. Its IUPAC name is 9-hydroxy-2,6,8-tris[(4-hydroxyphenyl)methyl]-2-methoxycyclopenta[a]naphthalene-1,3-dione.
| Compound Name | 9-hydroxy-2,6,8-tris[(4-hydroxyphenyl)methyl]-2-methoxycyclopenta[a]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 170995384 |
| Molecular Formula | C35H28O7 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 9-hydroxy-2,6,8-tris[(4-hydroxyphenyl)methyl]-2-methoxycyclopenta[a]naphthalene-1,3-dione |
| SMILES | COC1(Cc2ccc(O)cc2)C(=O)c2ccc3c(Cc4ccc(O)cc4)cc(Cc4ccc(O)cc4)c(O)c3c2C1=O |
| InChI | InChI=1S/C35H28O7/c1-42-35(19-22-6-12-27(38)13-7-22)33(40)29-15-14-28-23(16-20-2-8-25(36)9-3-20)18-24(17-21-4-10-26(37)11-5-21)32(39)30(28)31(29)34(35)41/h2-15,18,36-39H,16-17,19H2,1H3 |
| InChIKey | CZCOAIKIPLJLSX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'keto_naphthol_A(2)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|