C25H41NO9 — CID 170996915
(1S,2R,3R,4R,5S,6S,7S,8R,10R,13R,14R,16S,17S,18R)-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8,14-pentol (PubChem CID 170996915) has the molecular formula C25H41NO9 and a molecular weight of 499.60 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S,6S,7S,8R,10R,13R,14R,16S,17S,18R)-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8,14-pentol.
| Compound Name | (1S,2R,3R,4R,5S,6S,7S,8R,10R,13R,14R,16S,17S,18R)-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8,14-pentol |
|---|---|
| PubChem CID | 170996915 |
| Molecular Formula | C25H41NO9 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | (1S,2R,3R,4R,5S,6S,7S,8R,10R,13R,14R,16S,17S,18R)-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8,14-pentol |
| SMILES | CCN1C[C@]2(COC)[C@H](O)C[C@H](OC)[C@@]34[C@@H]5C[C@]6(O)[C@H](O)[C@@H]5[C@@](O)(C(C(OC)[C@H]23)[C@@H]14)[C@@H](O)[C@@H]6OC |
| InChI | InChI=1S/C25H41NO9/c1-6-26-9-22(10-32-2)12(27)7-13(33-3)24-11-8-23(30)19(28)14(11)25(31,20(29)21(23)35-5)15(18(24)26)16(34-4)17(22)24/h11-21,27-31H,6-10H2,1-5H3/t11-,12-,13+,14-,15?,16?,17-,18-,19-,20+,21+,22+,23+,24+,25-/m1/s1 |
| InChIKey | SQMGCPHFHQGPIF-LUDMHCCZSA-N |
| XLogP | -1.79 |
| TPSA | 141.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |