C7H6Br2OS — CID 171002224
3,6-dibromo-2-methoxybenzenethiol (PubChem CID 171002224) has the molecular formula C7H6Br2OS and a molecular weight of 298.00 g/mol. Its IUPAC name is 3,6-dibromo-2-methoxybenzenethiol.
| Compound Name | 3,6-dibromo-2-methoxybenzenethiol |
|---|---|
| PubChem CID | 171002224 |
| Molecular Formula | C7H6Br2OS |
| Molecular Weight | 298.00 g/mol |
| Exact Mass | 295.85 |
| IUPAC Name | 3,6-dibromo-2-methoxybenzenethiol |
| SMILES | COc1c(Br)ccc(Br)c1S |
| InChI | InChI=1S/C7H6Br2OS/c1-10-6-4(8)2-3-5(9)7(6)11/h2-3,11H,1H3 |
| InChIKey | XPFVZVCHMSEDQW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.00 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|