C11H9NO3 — CID 171031040
2-ethoxy-4,6-diformylbenzonitrile (PubChem CID 171031040) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 2-ethoxy-4,6-diformylbenzonitrile.
| Compound Name | 2-ethoxy-4,6-diformylbenzonitrile |
|---|---|
| PubChem CID | 171031040 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2-ethoxy-4,6-diformylbenzonitrile |
| SMILES | CCOc1cc(C=O)cc(C=O)c1C#N |
| InChI | InChI=1S/C11H9NO3/c1-2-15-11-4-8(6-13)3-9(7-14)10(11)5-12/h3-4,6-7H,2H2,1H3 |
| InChIKey | VWGNASVGHKBORH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|