C11H20N5O13P3S — CID 171035573
[[5-(2-amino-6-hydroxy-6-methyl-3H-purin-9-yl)-3-hydroxy-4-sulfanyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 171035573) has the molecular formula C11H20N5O13P3S and a molecular weight of 555.29 g/mol. Its IUPAC name is [[5-(2-amino-6-hydroxy-6-methyl-3H-purin-9-yl)-3-hydroxy-4-sulfanyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(2-amino-6-hydroxy-6-methyl-3H-purin-9-yl)-3-hydroxy-4-sulfanyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 171035573 |
| Molecular Formula | C11H20N5O13P3S |
| Molecular Weight | 555.29 g/mol |
| Exact Mass | 555.00 |
| IUPAC Name | [[5-(2-amino-6-hydroxy-6-methyl-3H-purin-9-yl)-3-hydroxy-4-sulfanyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC1(O)N=C(N)Nc2c1ncn2C1OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1S |
| InChI | InChI=1S/C11H20N5O13P3S/c1-11(18)7-8(14-10(12)15-11)16(3-13-7)9-6(33)5(17)4(27-9)2-26-31(22,23)29-32(24,25)28-30(19,20)21/h3-6,9,17-18,33H,2H2,1H3,(H,22,23)(H,24,25)(H3,12,14,15)(H2,19,20,21) |
| InChIKey | QGSISBAYWFFHFD-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 277.74 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.29 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|