C25H24N2O2S2 — CID 171038487
(5E)-5-(6-ethyl-9,11,11-trimethyl-2-oxo-9-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 171038487) has the molecular formula C25H24N2O2S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is (5E)-5-(6-ethyl-9,11,11-trimethyl-2-oxo-9-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-(6-ethyl-9,11,11-trimethyl-2-oxo-9-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171038487 |
| Molecular Formula | C25H24N2O2S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (5E)-5-(6-ethyl-9,11,11-trimethyl-2-oxo-9-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCc1cc2c3c(c1)C(C)(c1ccccc1)CC(C)(C)N3C(=O)/C2=C1/SC(=S)NC1=O |
| InChI | InChI=1S/C25H24N2O2S2/c1-5-14-11-16-18(20-21(28)26-23(30)31-20)22(29)27-19(16)17(12-14)25(4,13-24(27,2)3)15-9-7-6-8-10-15/h6-12H,5,13H2,1-4H3,(H,26,28,30)/b20-18+ |
| InChIKey | HZVSEMGGCPRGPO-CZIZESTLSA-N |
| XLogP | 4.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|