C25H24N2O3 — CID 19630954
ethyl (2E)-2-cyano-2-(9,11,11-trimethyl-2-oxo-9-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-ylidene)acetate (PubChem CID 19630954) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is ethyl (2E)-2-cyano-2-(9,11,11-trimethyl-2-oxo-9-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-ylidene)acetate.
| Compound Name | ethyl (2E)-2-cyano-2-(9,11,11-trimethyl-2-oxo-9-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-ylidene)acetate |
|---|---|
| PubChem CID | 19630954 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | ethyl (2E)-2-cyano-2-(9,11,11-trimethyl-2-oxo-9-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-ylidene)acetate |
| SMILES | CCOC(=O)/C(C#N)=C1/C(=O)N2c3c1cccc3C(C)(c1ccccc1)CC2(C)C |
| InChI | InChI=1S/C25H24N2O3/c1-5-30-23(29)18(14-26)20-17-12-9-13-19-21(17)27(22(20)28)24(2,3)15-25(19,4)16-10-7-6-8-11-16/h6-13H,5,15H2,1-4H3/b20-18+ |
| InChIKey | BAPFORCEHAKPSB-CZIZESTLSA-N |
| XLogP | 4.36 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|