C23H44N3O5 — CID 171042246
CID 171042246 (PubChem CID 171042246) has the molecular formula C23H44N3O5 and a molecular weight of 446.65 g/mol.
| Compound Name | CID 171042246 |
|---|---|
| PubChem CID | 171042246 |
| Molecular Formula | C23H44N3O5 |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.35 |
| IUPAC Name | — |
| SMILES | CC(C)C.[2H]C([2H])([2H])[C@]([2H])(N[C@@H](CCC)C(=O)OCC)C(=O)N1[C@H](C(=O)O)C[C@@H]2CCCC[C@@H]21.[NH2] |
| InChI | InChI=1S/C19H32N2O5.C4H10.H2N/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24;1-4(2)3;/h12-16,20H,4-11H2,1-3H3,(H,23,24);4H,1-3H3;1H2/t12-,13-,14-,15-,16-;;/m0../s1/i3D3,12D;; |
| InChIKey | BVDGAPZRSBLITH-SPKGNDENSA-N |
| XLogP | 3.55 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |