C38H51NO12 — CID 171051982
4-[4-[3,5-bis(2-methylpropanoyloxy)benzoyl]oxybutylamino]butyl 3,5-bis(2-methylpropanoyloxy)benzoate (PubChem CID 171051982) has the molecular formula C38H51NO12 and a molecular weight of 713.82 g/mol. Its IUPAC name is 4-[4-[3,5-bis(2-methylpropanoyloxy)benzoyl]oxybutylamino]butyl 3,5-bis(2-methylpropanoyloxy)benzoate.
| Compound Name | 4-[4-[3,5-bis(2-methylpropanoyloxy)benzoyl]oxybutylamino]butyl 3,5-bis(2-methylpropanoyloxy)benzoate |
|---|---|
| PubChem CID | 171051982 |
| Molecular Formula | C38H51NO12 |
| Molecular Weight | 713.82 g/mol |
| Exact Mass | 713.34 |
| IUPAC Name | 4-[4-[3,5-bis(2-methylpropanoyloxy)benzoyl]oxybutylamino]butyl 3,5-bis(2-methylpropanoyloxy)benzoate |
| SMILES | CC(C)C(=O)Oc1cc(OC(=O)C(C)C)cc(C(=O)OCCCCNCCCCOC(=O)c2cc(OC(=O)C(C)C)cc(OC(=O)C(C)C)c2)c1 |
| InChI | InChI=1S/C38H51NO12/c1-23(2)33(40)48-29-17-27(18-30(21-29)49-34(41)24(3)4)37(44)46-15-11-9-13-39-14-10-12-16-47-38(45)28-19-31(50-35(42)25(5)6)22-32(20-28)51-36(43)26(7)8/h17-26,39H,9-16H2,1-8H3 |
| InChIKey | HGEFCTAXPWPAHO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.82 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|