C20H15N5O — CID 171053445
[4-(6,9,14,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,11(16),12,14-octaen-2-ylamino)phenyl]methanol (PubChem CID 171053445) has the molecular formula C20H15N5O and a molecular weight of 341.37 g/mol. Its IUPAC name is [4-(6,9,14,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,11(16),12,14-octaen-2-ylamino)phenyl]methanol.
| Compound Name | [4-(6,9,14,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,11(16),12,14-octaen-2-ylamino)phenyl]methanol |
|---|---|
| PubChem CID | 171053445 |
| Molecular Formula | C20H15N5O |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [4-(6,9,14,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,11(16),12,14-octaen-2-ylamino)phenyl]methanol |
| SMILES | OCc1ccc(Nc2c3ccncc3nc3c2[nH]c2cnccc23)cc1 |
| InChI | InChI=1S/C20H15N5O/c26-11-12-1-3-13(4-2-12)23-18-14-5-7-21-9-16(14)24-19-15-6-8-22-10-17(15)25-20(18)19/h1-10,25-26H,11H2,(H,23,24) |
| InChIKey | HNHWNVYJFDGDRW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |