C14H20N2O3 — CID 171059096
(E)-N,N-diethyl-3-(phenylcarbamoyloxy)prop-1-en-1-amine oxide (PubChem CID 171059096) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (E)-N,N-diethyl-3-(phenylcarbamoyloxy)prop-1-en-1-amine oxide.
| Compound Name | (E)-N,N-diethyl-3-(phenylcarbamoyloxy)prop-1-en-1-amine oxide |
|---|---|
| PubChem CID | 171059096 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (E)-N,N-diethyl-3-(phenylcarbamoyloxy)prop-1-en-1-amine oxide |
| SMILES | CC[N+]([O-])(/C=C/COC(=O)Nc1ccccc1)CC |
| InChI | InChI=1S/C14H20N2O3/c1-3-16(18,4-2)11-8-12-19-14(17)15-13-9-6-5-7-10-13/h5-11H,3-4,12H2,1-2H3,(H,15,17)/b11-8+ |
| InChIKey | KTLYMQODIXFJQR-DHZHZOJOSA-N |
| XLogP | 3.10 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|