About 3-methylbut-2-enyl N-phenylcarbamate
3-methylbut-2-enyl N-phenylcarbamate (PubChem CID 824835) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-methylbut-2-enyl N-phenylcarbamate.
Molecular Properties
| Compound Name | 3-methylbut-2-enyl N-phenylcarbamate |
| PubChem CID | 824835 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-methylbut-2-enyl N-phenylcarbamate |
| SMILES | CC(C)=CCOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c1-10(2)8-9-15-12(14)13-11-6-4-3-5-7-11/h3-8H,9H2,1-2H3,(H,13,14) |
| InChIKey | NTMVLXFTQLVNAQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enyl N-phenylcarbamate?
The IUPAC name of 3-methylbut-2-enyl N-phenylcarbamate (CID 824835) is 3-methylbut-2-enyl N-phenylcarbamate.
What is the SMILES notation for 3-methylbut-2-enyl N-phenylcarbamate?
The canonical SMILES for 3-methylbut-2-enyl N-phenylcarbamate is CC(C)=CCOC(=O)Nc1ccccc1.
What is the InChIKey of 3-methylbut-2-enyl N-phenylcarbamate?
The InChIKey is NTMVLXFTQLVNAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-10(2)8-9-15-12(14)13-11-6-4-3-5-7-11/h3-8H,9H2,1-2H3,(H,13,14).
What are the key properties of 3-methylbut-2-enyl N-phenylcarbamate?
3-methylbut-2-enyl N-phenylcarbamate has a molecular weight of 205.26 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl N-phenylcarbamate is sourced from PubChem (CID 824835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).