C46H32N4O7 — CID 171061770
9-N,15-N-bis(4-methoxyphenyl)-9-N,15-N-bis(4-nitrophenyl)-12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-9,15-diamine (PubChem CID 171061770) has the molecular formula C46H32N4O7 and a molecular weight of 752.78 g/mol. Its IUPAC name is 9-N,15-N-bis(4-methoxyphenyl)-9-N,15-N-bis(4-nitrophenyl)-12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-9,15-diamine.
| Compound Name | 9-N,15-N-bis(4-methoxyphenyl)-9-N,15-N-bis(4-nitrophenyl)-12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-9,15-diamine |
|---|---|
| PubChem CID | 171061770 |
| Molecular Formula | C46H32N4O7 |
| Molecular Weight | 752.78 g/mol |
| Exact Mass | 752.23 |
| IUPAC Name | 9-N,15-N-bis(4-methoxyphenyl)-9-N,15-N-bis(4-nitrophenyl)-12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-9,15-diamine |
| SMILES | COc1ccc(N(c2ccc([N+](=O)[O-])cc2)c2cc3oc4cc(N(c5ccc(OC)cc5)c5ccc([N+](=O)[O-])cc5)c5ccccc5c4c3c3ccccc23)cc1 |
| InChI | InChI=1S/C46H32N4O7/c1-55-35-23-19-31(20-24-35)47(29-11-15-33(16-12-29)49(51)52)41-27-43-45(39-9-5-3-7-37(39)41)46-40-10-6-4-8-38(40)42(28-44(46)57-43)48(32-21-25-36(56-2)26-22-32)30-13-17-34(18-14-30)50(53)54/h3-28H,1-2H3 |
| InChIKey | LQAOJFBGZXXJKW-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 124.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.78 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|