C23H28ClNO3 — CID 171066087
tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-[3-(hydroxymethyl)cyclobutyl]carbamate (PubChem CID 171066087) has the molecular formula C23H28ClNO3 and a molecular weight of 401.93 g/mol. Its IUPAC name is tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-[3-(hydroxymethyl)cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-[3-(hydroxymethyl)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 171066087 |
| Molecular Formula | C23H28ClNO3 |
| Molecular Weight | 401.93 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-[3-(hydroxymethyl)cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(-c2ccccc2)c(Cl)c1)C1CC(CO)C1 |
| InChI | InChI=1S/C23H28ClNO3/c1-23(2,3)28-22(27)25(19-11-17(12-19)15-26)14-16-9-10-20(21(24)13-16)18-7-5-4-6-8-18/h4-10,13,17,19,26H,11-12,14-15H2,1-3H3 |
| InChIKey | CNDBRTQIHHTTFH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.93 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |