C26H27F3N8O — CID 171067453
6-pyridazin-4-yl-N-[2-[4-[[5-(trifluoromethyl)-1H-indol-2-yl]methylamino]butoxy]ethyl]-2H-benzotriazol-4-amine (PubChem CID 171067453) has the molecular formula C26H27F3N8O and a molecular weight of 524.55 g/mol. Its IUPAC name is 6-pyridazin-4-yl-N-[2-[4-[[5-(trifluoromethyl)-1H-indol-2-yl]methylamino]butoxy]ethyl]-2H-benzotriazol-4-amine.
| Compound Name | 6-pyridazin-4-yl-N-[2-[4-[[5-(trifluoromethyl)-1H-indol-2-yl]methylamino]butoxy]ethyl]-2H-benzotriazol-4-amine |
|---|---|
| PubChem CID | 171067453 |
| Molecular Formula | C26H27F3N8O |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 6-pyridazin-4-yl-N-[2-[4-[[5-(trifluoromethyl)-1H-indol-2-yl]methylamino]butoxy]ethyl]-2H-benzotriazol-4-amine |
| SMILES | FC(F)(F)c1ccc2[nH]c(CNCCCCOCCNc3cc(-c4ccnnc4)cc4n[nH]nc34)cc2c1 |
| InChI | InChI=1S/C26H27F3N8O/c27-26(28,29)20-3-4-22-19(11-20)12-21(34-22)16-30-6-1-2-9-38-10-8-31-23-13-18(17-5-7-32-33-15-17)14-24-25(23)36-37-35-24/h3-5,7,11-15,30-31,34H,1-2,6,8-10,16H2,(H,35,36,37) |
| InChIKey | FJKUKDUMRVCCBH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|