C29H31F3N6O2 — CID 171067651
6-(2-methoxy-4-pyridinyl)-N-[2-[4-[[5-(trifluoromethyl)-1H-indol-2-yl]methylamino]butoxy]ethyl]-1H-indazol-4-amine (PubChem CID 171067651) has the molecular formula C29H31F3N6O2 and a molecular weight of 552.60 g/mol. Its IUPAC name is 6-(2-methoxy-4-pyridinyl)-N-[2-[4-[[5-(trifluoromethyl)-1H-indol-2-yl]methylamino]butoxy]ethyl]-1H-indazol-4-amine.
| Compound Name | 6-(2-methoxy-4-pyridinyl)-N-[2-[4-[[5-(trifluoromethyl)-1H-indol-2-yl]methylamino]butoxy]ethyl]-1H-indazol-4-amine |
|---|---|
| PubChem CID | 171067651 |
| Molecular Formula | C29H31F3N6O2 |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 6-(2-methoxy-4-pyridinyl)-N-[2-[4-[[5-(trifluoromethyl)-1H-indol-2-yl]methylamino]butoxy]ethyl]-1H-indazol-4-amine |
| SMILES | COc1cc(-c2cc(NCCOCCCCNCc3cc4cc(C(F)(F)F)ccc4[nH]3)c3cn[nH]c3c2)ccn1 |
| InChI | InChI=1S/C29H31F3N6O2/c1-39-28-16-19(6-8-35-28)20-14-26(24-18-36-38-27(24)15-20)34-9-11-40-10-3-2-7-33-17-23-13-21-12-22(29(30,31)32)4-5-25(21)37-23/h4-6,8,12-16,18,33-34,37H,2-3,7,9-11,17H2,1H3,(H,36,38) |
| InChIKey | FNQKUVVOXHNMEW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|