C19H19N3O7 — CID 171073095
2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxymethyl]morpholine-4-carbaldehyde (PubChem CID 171073095) has the molecular formula C19H19N3O7 and a molecular weight of 401.38 g/mol. Its IUPAC name is 2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxymethyl]morpholine-4-carbaldehyde.
| Compound Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxymethyl]morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 171073095 |
| Molecular Formula | C19H19N3O7 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxymethyl]morpholine-4-carbaldehyde |
| SMILES | O=CN1CCOC(COc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C19H19N3O7/c23-10-21-6-7-28-11(8-21)9-29-14-3-1-2-12-16(14)19(27)22(18(12)26)13-4-5-15(24)20-17(13)25/h1-3,10-11,13H,4-9H2,(H,20,24,25) |
| InChIKey | LLWVPVOEMLYMFA-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|