C28H21N5O — CID 171073725
3,7-bis(1-methylindazol-5-yl)-10H-phenoxazine (PubChem CID 171073725) has the molecular formula C28H21N5O and a molecular weight of 443.51 g/mol. Its IUPAC name is 3,7-bis(1-methylindazol-5-yl)-10H-phenoxazine.
| Compound Name | 3,7-bis(1-methylindazol-5-yl)-10H-phenoxazine |
|---|---|
| PubChem CID | 171073725 |
| Molecular Formula | C28H21N5O |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 3,7-bis(1-methylindazol-5-yl)-10H-phenoxazine |
| SMILES | Cn1ncc2cc(-c3ccc4c(c3)Oc3cc(-c5ccc6c(cnn6C)c5)ccc3N4)ccc21 |
| InChI | InChI=1S/C28H21N5O/c1-32-25-9-5-17(11-21(25)15-29-32)19-3-7-23-27(13-19)34-28-14-20(4-8-24(28)31-23)18-6-10-26-22(12-18)16-30-33(26)2/h3-16,31H,1-2H3 |
| InChIKey | OJYCCLCWHSMTMQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |