C46H91N3O5 — CID 171073931
3-[3-[2-(dimethylamino)ethyl-methylamino]propanoyl-[3-(2-hexyldecoxy)-3-oxopropyl]amino]propyl 2-hexyldecanoate (PubChem CID 171073931) has the molecular formula C46H91N3O5 and a molecular weight of 766.25 g/mol. Its IUPAC name is 3-[3-[2-(dimethylamino)ethyl-methylamino]propanoyl-[3-(2-hexyldecoxy)-3-oxopropyl]amino]propyl 2-hexyldecanoate.
| Compound Name | 3-[3-[2-(dimethylamino)ethyl-methylamino]propanoyl-[3-(2-hexyldecoxy)-3-oxopropyl]amino]propyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 171073931 |
| Molecular Formula | C46H91N3O5 |
| Molecular Weight | 766.25 g/mol |
| Exact Mass | 765.70 |
| IUPAC Name | 3-[3-[2-(dimethylamino)ethyl-methylamino]propanoyl-[3-(2-hexyldecoxy)-3-oxopropyl]amino]propyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCN(CCCOC(=O)C(CCCCCC)CCCCCCCC)C(=O)CCN(C)CCN(C)C |
| InChI | InChI=1S/C46H91N3O5/c1-8-12-16-20-22-25-30-42(29-24-18-14-10-3)41-54-45(51)34-37-49(44(50)33-36-48(7)39-38-47(5)6)35-28-40-53-46(52)43(31-26-19-15-11-4)32-27-23-21-17-13-9-2/h42-43H,8-41H2,1-7H3 |
| InChIKey | VLFZGAUMCIIZLP-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.25 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|