C12H15ClO4 — CID 171074474
1-[5-chloro-2-hydroxy-3-(2-methoxyethoxymethyl)phenyl]ethanone (PubChem CID 171074474) has the molecular formula C12H15ClO4 and a molecular weight of 258.70 g/mol. Its IUPAC name is 1-[5-chloro-2-hydroxy-3-(2-methoxyethoxymethyl)phenyl]ethanone.
| Compound Name | 1-[5-chloro-2-hydroxy-3-(2-methoxyethoxymethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 171074474 |
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-[5-chloro-2-hydroxy-3-(2-methoxyethoxymethyl)phenyl]ethanone |
| SMILES | COCCOCc1cc(Cl)cc(C(C)=O)c1O |
| InChI | InChI=1S/C12H15ClO4/c1-8(14)11-6-10(13)5-9(12(11)15)7-17-4-3-16-2/h5-6,15H,3-4,7H2,1-2H3 |
| InChIKey | VMCOQNAAXAEGNI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|