C18H16BrClF3NO4 — CID 176911559
N-[2-bromo-4-(trifluoromethyl)phenyl]-5-chloro-2-hydroxy-3-(2-methoxyethoxymethyl)benzamide (PubChem CID 176911559) has the molecular formula C18H16BrClF3NO4 and a molecular weight of 482.68 g/mol. Its IUPAC name is N-[2-bromo-4-(trifluoromethyl)phenyl]-5-chloro-2-hydroxy-3-(2-methoxyethoxymethyl)benzamide.
| Compound Name | N-[2-bromo-4-(trifluoromethyl)phenyl]-5-chloro-2-hydroxy-3-(2-methoxyethoxymethyl)benzamide |
|---|---|
| PubChem CID | 176911559 |
| Molecular Formula | C18H16BrClF3NO4 |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | N-[2-bromo-4-(trifluoromethyl)phenyl]-5-chloro-2-hydroxy-3-(2-methoxyethoxymethyl)benzamide |
| SMILES | COCCOCc1cc(Cl)cc(C(=O)Nc2ccc(C(F)(F)F)cc2Br)c1O |
| InChI | InChI=1S/C18H16BrClF3NO4/c1-27-4-5-28-9-10-6-12(20)8-13(16(10)25)17(26)24-15-3-2-11(7-14(15)19)18(21,22)23/h2-3,6-8,25H,4-5,9H2,1H3,(H,24,26) |
| InChIKey | LHEJXFIQKNYGDM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|