C19H16ClF3N2O3S — CID 171074266
5-chloro-2-hydroxy-3-(3-methoxypropyl)-N-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]benzamide (PubChem CID 171074266) has the molecular formula C19H16ClF3N2O3S and a molecular weight of 444.86 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-3-(3-methoxypropyl)-N-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | 5-chloro-2-hydroxy-3-(3-methoxypropyl)-N-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 171074266 |
| Molecular Formula | C19H16ClF3N2O3S |
| Molecular Weight | 444.86 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 5-chloro-2-hydroxy-3-(3-methoxypropyl)-N-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]benzamide |
| SMILES | COCCCc1cc(Cl)cc(C(=O)Nc2nc3ccc(C(F)(F)F)cc3s2)c1O |
| InChI | InChI=1S/C19H16ClF3N2O3S/c1-28-6-2-3-10-7-12(20)9-13(16(10)26)17(27)25-18-24-14-5-4-11(19(21,22)23)8-15(14)29-18/h4-5,7-9,26H,2-3,6H2,1H3,(H,24,25,27) |
| InChIKey | MQRBWYXIDKVJDV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.86 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|