C17H13ClF3N3OS — CID 174314138
2-(aminomethyl)-4-chloro-6-[1-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]ethenyl]phenol (PubChem CID 174314138) has the molecular formula C17H13ClF3N3OS and a molecular weight of 399.83 g/mol. Its IUPAC name is 2-(aminomethyl)-4-chloro-6-[1-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]ethenyl]phenol.
| Compound Name | 2-(aminomethyl)-4-chloro-6-[1-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]ethenyl]phenol |
|---|---|
| PubChem CID | 174314138 |
| Molecular Formula | C17H13ClF3N3OS |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 2-(aminomethyl)-4-chloro-6-[1-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]ethenyl]phenol |
| SMILES | C=C(Nc1nc2ccc(C(F)(F)F)cc2s1)c1cc(Cl)cc(CN)c1O |
| InChI | InChI=1S/C17H13ClF3N3OS/c1-8(12-6-11(18)4-9(7-22)15(12)25)23-16-24-13-3-2-10(17(19,20)21)5-14(13)26-16/h2-6,25H,1,7,22H2,(H,23,24) |
| InChIKey | ILHWNSGUZHXKFR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|