C19H17ClF2N2O4S — CID 171074595
5-chloro-N-[6-(difluoromethyl)-1,3-benzothiazol-2-yl]-2-hydroxy-3-(2-methoxyethoxymethyl)benzamide (PubChem CID 171074595) has the molecular formula C19H17ClF2N2O4S and a molecular weight of 442.87 g/mol. Its IUPAC name is 5-chloro-N-[6-(difluoromethyl)-1,3-benzothiazol-2-yl]-2-hydroxy-3-(2-methoxyethoxymethyl)benzamide.
| Compound Name | 5-chloro-N-[6-(difluoromethyl)-1,3-benzothiazol-2-yl]-2-hydroxy-3-(2-methoxyethoxymethyl)benzamide |
|---|---|
| PubChem CID | 171074595 |
| Molecular Formula | C19H17ClF2N2O4S |
| Molecular Weight | 442.87 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 5-chloro-N-[6-(difluoromethyl)-1,3-benzothiazol-2-yl]-2-hydroxy-3-(2-methoxyethoxymethyl)benzamide |
| SMILES | COCCOCc1cc(Cl)cc(C(=O)Nc2nc3ccc(C(F)F)cc3s2)c1O |
| InChI | InChI=1S/C19H17ClF2N2O4S/c1-27-4-5-28-9-11-6-12(20)8-13(16(11)25)18(26)24-19-23-14-3-2-10(17(21)22)7-15(14)29-19/h2-3,6-8,17,25H,4-5,9H2,1H3,(H,23,24,26) |
| InChIKey | UYKIQTOLDPNWEN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.87 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|