C22H26Cl2F3NO4 — CID 171074614
5-chloro-N-[(2Z,4Z,6Z)-2-chloro-7-methyl-6-(trifluoromethyl)nona-2,4,6-trien-3-yl]-2-hydroxy-3-(2-methoxyethoxymethyl)benzamide (PubChem CID 171074614) has the molecular formula C22H26Cl2F3NO4 and a molecular weight of 496.35 g/mol. Its IUPAC name is 5-chloro-N-[(2Z,4Z,6Z)-2-chloro-7-methyl-6-(trifluoromethyl)nona-2,4,6-trien-3-yl]-2-hydroxy-3-(2-methoxyethoxymethyl)benzamide.
| Compound Name | 5-chloro-N-[(2Z,4Z,6Z)-2-chloro-7-methyl-6-(trifluoromethyl)nona-2,4,6-trien-3-yl]-2-hydroxy-3-(2-methoxyethoxymethyl)benzamide |
|---|---|
| PubChem CID | 171074614 |
| Molecular Formula | C22H26Cl2F3NO4 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 5-chloro-N-[(2Z,4Z,6Z)-2-chloro-7-methyl-6-(trifluoromethyl)nona-2,4,6-trien-3-yl]-2-hydroxy-3-(2-methoxyethoxymethyl)benzamide |
| SMILES | CC/C(C)=C(/C=C\C(NC(=O)c1cc(Cl)cc(COCCOC)c1O)=C(/C)Cl)C(F)(F)F |
| InChI | InChI=1S/C22H26Cl2F3NO4/c1-5-13(2)18(22(25,26)27)6-7-19(14(3)23)28-21(30)17-11-16(24)10-15(20(17)29)12-32-9-8-31-4/h6-7,10-11,29H,5,8-9,12H2,1-4H3,(H,28,30)/b7-6-,18-13-,19-14- |
| InChIKey | LBLYHMOXZVHSAL-YNCLTASNSA-N |
| XLogP | 6.25 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|