C27H38ClF3N4O4 — CID 171074395
N-[N-[2-(aminomethyl)-6-methyl-4-(trifluoromethyl)phenyl]-C-methylcarbonimidoyl]-3-[[bis(2-methoxyethyl)amino]methyl]-5-chloro-2-hydroxybenzamide;ethane (PubChem CID 171074395) has the molecular formula C27H38ClF3N4O4 and a molecular weight of 575.07 g/mol. Its IUPAC name is N-[N-[2-(aminomethyl)-6-methyl-4-(trifluoromethyl)phenyl]-C-methylcarbonimidoyl]-3-[[bis(2-methoxyethyl)amino]methyl]-5-chloro-2-hydroxybenzamide;ethane.
| Compound Name | N-[N-[2-(aminomethyl)-6-methyl-4-(trifluoromethyl)phenyl]-C-methylcarbonimidoyl]-3-[[bis(2-methoxyethyl)amino]methyl]-5-chloro-2-hydroxybenzamide;ethane |
|---|---|
| PubChem CID | 171074395 |
| Molecular Formula | C27H38ClF3N4O4 |
| Molecular Weight | 575.07 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | N-[N-[2-(aminomethyl)-6-methyl-4-(trifluoromethyl)phenyl]-C-methylcarbonimidoyl]-3-[[bis(2-methoxyethyl)amino]methyl]-5-chloro-2-hydroxybenzamide;ethane |
| SMILES | CC.COCCN(CCOC)Cc1cc(Cl)cc(C(=O)N/C(C)=N/c2c(C)cc(C(F)(F)F)cc2CN)c1O |
| InChI | InChI=1S/C25H32ClF3N4O4.C2H6/c1-15-9-19(25(27,28)29)10-17(13-30)22(15)31-16(2)32-24(35)21-12-20(26)11-18(23(21)34)14-33(5-7-36-3)6-8-37-4;1-2/h9-12,34H,5-8,13-14,30H2,1-4H3,(H,31,32,35);1-2H3 |
| InChIKey | ZWAFKCFBGJBUAU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.07 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|