About 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide
5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide (PubChem CID 171074476) has the molecular formula C15H21ClN2O3
and a molecular weight of 312.80 g/mol. Its IUPAC name is 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide.
Molecular Properties
| Compound Name | 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide |
| PubChem CID | 171074476 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(Cl)cc(CN2CC(C)O[C@H](C)C2)c1O |
| InChI | InChI=1S/C15H21ClN2O3/c1-9-6-18(7-10(2)21-9)8-11-4-12(16)5-13(14(11)19)15(20)17-3/h4-5,9-10,19H,6-8H2,1-3H3,(H,17,20)/t9-,10?/m1/s1 |
| InChIKey | HMMJEYHGSLUCTO-YHMJZVADSA-N |
| XLogP | 2.01 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide?
The IUPAC name of 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide (CID 171074476) is 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide.
What is the SMILES notation for 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide?
The canonical SMILES for 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide is CNC(=O)c1cc(Cl)cc(CN2CC(C)O[C@H](C)C2)c1O.
What is the InChIKey of 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide?
The InChIKey is HMMJEYHGSLUCTO-YHMJZVADSA-N. The full InChI is InChI=1S/C15H21ClN2O3/c1-9-6-18(7-10(2)21-9)8-11-4-12(16)5-13(14(11)19)15(20)17-3/h4-5,9-10,19H,6-8H2,1-3H3,(H,17,20)/t9-,10?/m1/s1.
What are the key properties of 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide?
5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide has a molecular weight of 312.80 g/mol, XLogP of 2.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-[[(2R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-methylbenzamide is sourced from PubChem (CID 171074476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).