C13H30N2 — CID 171081221
N-butyl-2-ethyl-N,N',N'-trimethylbutane-1,4-diamine (PubChem CID 171081221) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is N-butyl-2-ethyl-N,N',N'-trimethylbutane-1,4-diamine.
| Compound Name | N-butyl-2-ethyl-N,N',N'-trimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 171081221 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | N-butyl-2-ethyl-N,N',N'-trimethylbutane-1,4-diamine |
| SMILES | CCCCN(C)CC(CC)CCN(C)C |
| InChI | InChI=1S/C13H30N2/c1-6-8-10-15(5)12-13(7-2)9-11-14(3)4/h13H,6-12H2,1-5H3 |
| InChIKey | HGUSAUURYFOTHL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |