C14H33N — CID 144533444
ethane;N,N,3,4-tetramethyloctan-1-amine (PubChem CID 144533444) has the molecular formula C14H33N and a molecular weight of 215.42 g/mol. Its IUPAC name is ethane;N,N,3,4-tetramethyloctan-1-amine.
| Compound Name | ethane;N,N,3,4-tetramethyloctan-1-amine |
|---|---|
| PubChem CID | 144533444 |
| Molecular Formula | C14H33N |
| Molecular Weight | 215.42 g/mol |
| Exact Mass | 215.26 |
| IUPAC Name | ethane;N,N,3,4-tetramethyloctan-1-amine |
| SMILES | CC.CCCCC(C)C(C)CCN(C)C |
| InChI | InChI=1S/C12H27N.C2H6/c1-6-7-8-11(2)12(3)9-10-13(4)5;1-2/h11-12H,6-10H2,1-5H3;1-2H3 |
| InChIKey | VUYUEOFQYRWYLO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |