C32H49N3O7 — CID 171081379
tert-butyl 4-(3-methoxypropoxy)piperidine-1-carboxylate;tert-butyl N-[(6-phenylmethoxy-3-pyridinyl)methyl]carbamate (PubChem CID 171081379) has the molecular formula C32H49N3O7 and a molecular weight of 587.76 g/mol. Its IUPAC name is tert-butyl 4-(3-methoxypropoxy)piperidine-1-carboxylate;tert-butyl N-[(6-phenylmethoxy-3-pyridinyl)methyl]carbamate.
| Compound Name | tert-butyl 4-(3-methoxypropoxy)piperidine-1-carboxylate;tert-butyl N-[(6-phenylmethoxy-3-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 171081379 |
| Molecular Formula | C32H49N3O7 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.36 |
| IUPAC Name | tert-butyl 4-(3-methoxypropoxy)piperidine-1-carboxylate;tert-butyl N-[(6-phenylmethoxy-3-pyridinyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(OCc2ccccc2)nc1.COCCCOC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H22N2O3.C14H27NO4/c1-18(2,3)23-17(21)20-12-15-9-10-16(19-11-15)22-13-14-7-5-4-6-8-14;1-14(2,3)19-13(16)15-8-6-12(7-9-15)18-11-5-10-17-4/h4-11H,12-13H2,1-3H3,(H,20,21);12H,5-11H2,1-4H3 |
| InChIKey | GTBJUPRKRKJXQG-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|