C36H37N3O8S — CID 171083251
methyl 3-[6-methyl-1-(4-methylphenyl)sulfonyl-7-oxopyrrolo[2,3-c]pyridin-4-yl]-4-[3-(2-piperidin-4-yloxyethoxy)phenoxy]benzoate (PubChem CID 171083251) has the molecular formula C36H37N3O8S and a molecular weight of 671.77 g/mol. Its IUPAC name is methyl 3-[6-methyl-1-(4-methylphenyl)sulfonyl-7-oxopyrrolo[2,3-c]pyridin-4-yl]-4-[3-(2-piperidin-4-yloxyethoxy)phenoxy]benzoate.
| Compound Name | methyl 3-[6-methyl-1-(4-methylphenyl)sulfonyl-7-oxopyrrolo[2,3-c]pyridin-4-yl]-4-[3-(2-piperidin-4-yloxyethoxy)phenoxy]benzoate |
|---|---|
| PubChem CID | 171083251 |
| Molecular Formula | C36H37N3O8S |
| Molecular Weight | 671.77 g/mol |
| Exact Mass | 671.23 |
| IUPAC Name | methyl 3-[6-methyl-1-(4-methylphenyl)sulfonyl-7-oxopyrrolo[2,3-c]pyridin-4-yl]-4-[3-(2-piperidin-4-yloxyethoxy)phenoxy]benzoate |
| SMILES | COC(=O)c1ccc(Oc2cccc(OCCOC3CCNCC3)c2)c(-c2cn(C)c(=O)c3c2ccn3S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C36H37N3O8S/c1-24-7-10-29(11-8-24)48(42,43)39-18-15-30-32(23-38(2)35(40)34(30)39)31-21-25(36(41)44-3)9-12-33(31)47-28-6-4-5-27(22-28)46-20-19-45-26-13-16-37-17-14-26/h4-12,15,18,21-23,26,37H,13-14,16-17,19-20H2,1-3H3 |
| InChIKey | DJFBIPJGEMHTAN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.77 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|