C35H45N5O8S2 — CID 171083393
tert-butyl 4-[2-[[6-[4-(ethylsulfanylamino)-2-(1-ethylsulfonyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)phenoxy]-2-pyridinyl]oxy]ethoxy]piperidine-1-carboxylate (PubChem CID 171083393) has the molecular formula C35H45N5O8S2 and a molecular weight of 727.91 g/mol. Its IUPAC name is tert-butyl 4-[2-[[6-[4-(ethylsulfanylamino)-2-(1-ethylsulfonyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)phenoxy]-2-pyridinyl]oxy]ethoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[6-[4-(ethylsulfanylamino)-2-(1-ethylsulfonyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)phenoxy]-2-pyridinyl]oxy]ethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171083393 |
| Molecular Formula | C35H45N5O8S2 |
| Molecular Weight | 727.91 g/mol |
| Exact Mass | 727.27 |
| IUPAC Name | tert-butyl 4-[2-[[6-[4-(ethylsulfanylamino)-2-(1-ethylsulfonyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)phenoxy]-2-pyridinyl]oxy]ethoxy]piperidine-1-carboxylate |
| SMILES | CCSNc1ccc(Oc2cccc(OCCOC3CCN(C(=O)OC(C)(C)C)CC3)n2)c(-c2cn(C)c(=O)c3c2ccn3S(=O)(=O)CC)c1 |
| InChI | InChI=1S/C35H45N5O8S2/c1-7-49-37-24-12-13-29(27(22-24)28-23-38(6)33(41)32-26(28)16-19-40(32)50(43,44)8-2)47-31-11-9-10-30(36-31)46-21-20-45-25-14-17-39(18-15-25)34(42)48-35(3,4)5/h9-13,16,19,22-23,25,37H,7-8,14-15,17-18,20-21H2,1-6H3 |
| InChIKey | RZBOPPQSCKTMKI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.91 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|