C9H14N3O- — CID 171083554
4-[ethyl(propan-2-yl)amino]pyrimidin-2-olate (PubChem CID 171083554) has the molecular formula C9H14N3O- and a molecular weight of 180.23 g/mol. Its IUPAC name is 4-[ethyl(propan-2-yl)amino]pyrimidin-2-olate.
| Compound Name | 4-[ethyl(propan-2-yl)amino]pyrimidin-2-olate |
|---|---|
| PubChem CID | 171083554 |
| Molecular Formula | C9H14N3O- |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 4-[ethyl(propan-2-yl)amino]pyrimidin-2-olate |
| SMILES | CCN(c1ccnc([O-])n1)C(C)C |
| InChI | InChI=1S/C9H15N3O/c1-4-12(7(2)3)8-5-6-10-9(13)11-8/h5-7H,4H2,1-3H3,(H,10,11,13)/p-1 |
| InChIKey | ZUPOHQIUEPQNFT-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |