C22H28ClN3O3 — CID 171085275
tert-butyl 4-[[4-chloro-6-[ethyl(propan-2-yl)amino]pyridine-2-carbonyl]amino]benzoate (PubChem CID 171085275) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is tert-butyl 4-[[4-chloro-6-[ethyl(propan-2-yl)amino]pyridine-2-carbonyl]amino]benzoate.
| Compound Name | tert-butyl 4-[[4-chloro-6-[ethyl(propan-2-yl)amino]pyridine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 171085275 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | tert-butyl 4-[[4-chloro-6-[ethyl(propan-2-yl)amino]pyridine-2-carbonyl]amino]benzoate |
| SMILES | CCN(c1cc(Cl)cc(C(=O)Nc2ccc(C(=O)OC(C)(C)C)cc2)n1)C(C)C |
| InChI | InChI=1S/C22H28ClN3O3/c1-7-26(14(2)3)19-13-16(23)12-18(25-19)20(27)24-17-10-8-15(9-11-17)21(28)29-22(4,5)6/h8-14H,7H2,1-6H3,(H,24,27) |
| InChIKey | DJQFKAQEBITXJX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |