C23H24ClN5O — CID 171090500
(E)-3-amino-N-[(1-amino-5,7-dimethylisoquinolin-6-yl)methyl]-2-[(3-chlorophenyl)methyliminomethyl]prop-2-enamide (PubChem CID 171090500) has the molecular formula C23H24ClN5O and a molecular weight of 421.93 g/mol. Its IUPAC name is (E)-3-amino-N-[(1-amino-5,7-dimethylisoquinolin-6-yl)methyl]-2-[(3-chlorophenyl)methyliminomethyl]prop-2-enamide.
| Compound Name | (E)-3-amino-N-[(1-amino-5,7-dimethylisoquinolin-6-yl)methyl]-2-[(3-chlorophenyl)methyliminomethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171090500 |
| Molecular Formula | C23H24ClN5O |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | (E)-3-amino-N-[(1-amino-5,7-dimethylisoquinolin-6-yl)methyl]-2-[(3-chlorophenyl)methyliminomethyl]prop-2-enamide |
| SMILES | Cc1cc2c(N)nccc2c(C)c1CNC(=O)C(/C=N/Cc1cccc(Cl)c1)=C/N |
| InChI | InChI=1S/C23H24ClN5O/c1-14-8-20-19(6-7-28-22(20)26)15(2)21(14)13-29-23(30)17(10-25)12-27-11-16-4-3-5-18(24)9-16/h3-10,12H,11,13,25H2,1-2H3,(H2,26,28)(H,29,30)/b17-10+,27-12+ |
| InChIKey | GIUYAGAMCRYFNV-LEJVPHTCSA-N |
| XLogP | 3.82 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|